![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | (go to parent directory www.pauladaunt.com to use the search facility).rtf | 2016-12-07 14:20 | 486 | |
![[ ]](/icons/layout.gif) | 1-DunneJRealizingtheunreal.pdf | 2016-12-07 14:31 | 286K | |
| 27 Katas Shotokan Karate.pdf | 2016-12-07 14:11 | 6.6M | |
| 365 tarot spreads _ revealing the magic in each day.pdf | 2025-01-04 16:26 | 11M | |
![[TXT]](/icons/text.gif) | Abbie Hoffman - Steal This Book.txt | 2016-12-07 14:13 | 380K | |
| Aesop - Aesop's Fables.txt | 2016-12-07 14:43 | 62K | |
| Aikido The Art Of Fighting Without Fighting.pdf | 2016-12-07 14:43 | 2.7M | |
| Alan Watts - Philosophies Of Asia.pdf | 2016-12-07 14:27 | 344K | |
| Albert Einstein - Relativity.pdf | 2016-12-07 14:25 | 250K | |
| Albert Einstein - The World As I See It.txt | 2016-12-07 14:34 | 181K | |
| Aldous Huxley - The Doors of Perception.txt | 2016-12-07 14:05 | 105K | |
| Aldous_Huxley_-_Island.pdf | 2016-12-07 14:20 | 672K | |
| Aleister-Crowley-Meditation.pdf | 2017-04-22 06:47 | 442K | |
| Aleister-Crowley-The-Complete-Astrological-Writings-OCR.pdf | 2016-12-07 14:31 | 5.3M | |
| Aleister Crowley (Baphomet) - De Arte Magica.pdf | 2016-12-07 14:24 | 34K | |
| Aleister Crowley - Book of Lies.pdf | 2017-03-13 15:02 | 309K | |
| Aleister Crowley - Eight Lectures on Yoga.pdf | 2016-12-07 14:12 | 214K | |
| Aleister Crowley - Liber Samekh (800) - Theurgia Goetia Summ.txt | 2016-12-07 14:14 | 74K | |
| Aleister Crowley - Liber Samekh (800) - Theurgia Goetia Summa (Congressus Cum Daemone).txt | 2016-12-07 14:20 | 74K | |
| Aleister Crowley - The Book of the Law.pdf | 2016-12-07 14:16 | 90K | |
| Aleister Crowley - The book of Thoth.pdf | 2017-04-22 06:41 | 3.6M | |
| AleisterCrowley_LIBER777.pdf | 2017-04-22 06:49 | 742K | |
| Aleister Crowley_ THE RITES OF ELEUSIS_liber850.pdf | 2017-04-22 06:46 | 201K | |
| Aleister Crowley_TheStarRubyRitual.pdf | 2017-04-22 06:48 | 402K | |
| Aleister Crowley_goetia.pdf | 2017-04-22 06:46 | 601K | |
| Aleister_Crowley_bestequinox_sexmagick.pdf | 2017-04-22 06:38 | 556K | |
| Aleister_Crowley_equinox-iii.pdf | 2017-04-22 06:39 | 2.5M | |
| Aleister_Crowley_magick_in_theory_and_practice.pdf | 2017-03-13 15:06 | 1.0M | |
| Andrew Lang - The Arabian Nights.txt | 2016-12-07 14:20 | 582K | |
| AngelasAshes.doc | 2016-12-07 14:27 | 775K | |
| Anonymous - Beowulf.txt | 2016-12-07 14:36 | 143K | |
| Anthony Burgess - A Clockwork Orange.txt | 2016-12-07 14:34 | 83K | |
| Arp2600-FundamentalsOfMusicTechnology.pdf | 2016-12-07 14:43 | 1.6M | |
| ArtofWarbySunTzu.pdf | 2016-12-07 14:15 | 524K | |
![[DIR]](/icons/folder.gif) | Banned books and conspiracy theories/ | 2019-08-06 15:07 | - | |
| Book_of_Pleasure.pdf | 2016-12-07 14:12 | 250K | |
| Books in Portuguese/ | 2016-12-07 14:57 | - | |
| Bram Stoker - Dracula.txt | 2016-12-07 14:41 | 825K | |
| Bram Stoker - The Lair of the White Worm.txt | 2016-12-07 14:43 | 308K | |
| Buddhism/ | 2016-12-07 15:01 | - | |
| Camus/ | 2016-12-07 15:36 | - | |
| ChangingImagesOfMan-OCR.pdf | 2016-12-07 14:12 | 4.5M | |
| Chi Nei Tsang Internal Organs Chi Massage.pdf | 2016-12-07 14:38 | 8.3M | |
| Children's/ | 2016-12-07 15:33 | - | |
| Chinese Self healing Methods For Health.pdf | 2016-12-07 14:06 | 141K | |
| Christopher S Hyatt_Undoing Yourself With Energized Meditation And Other Devices.pdf | 2017-03-13 15:09 | 11M | |
| Classic Science Fiction/ | 2016-12-07 15:35 | - | |
| CodexSeraphinianus.pdf | 2016-12-07 14:48 | 54M | |
| Curse of Lono Hunter S Thompson.doc | 2016-12-07 14:36 | 446K | |
| Cyberpunk/ | 2016-12-07 15:35 | - | |
| D. H. Lawrence - Sons And Lovers.txt | 2016-12-07 14:43 | 867K | |
| David K. Cheng - Field and Wave Electromagnetics 2ed Solution Manual.pdf | 2016-12-07 14:14 | 3.3M | |
| Deschooling Society by Ivan Illich.pdf | 2016-12-07 14:44 | 443K | |
| Do It Yourself A Handbook for Changing our World.pdf | 2016-12-07 14:43 | 7.3M | |
| DuQuette - Aleister Crowleys Illustrated Goetia.pdf | 2024-12-26 21:16 | 7.2M | |
| Duquette - Low Magick_ It's All In Your Head... You Just Have No Idea How Big Your Head Is.pdf | 2024-12-26 21:19 | 3.0M | |
| Duquette - Understanding Aleister Crowley's Thoth Tarot.pdf | 2024-12-26 21:23 | 58M | |
| Dwyer_Terence_Composing_with_Tape_Recorders_Musique_Concrete_for_Beginners.pdf | 2016-12-07 14:24 | 28M | |
| EBOOK_TSOG_robert_anton_wilson 3/ | 2016-12-07 15:07 | - | |
| Ebook_-_Brainwave_-_EEG_and_Tr.pdf | 2016-12-07 14:34 | 53K | |
| FORSYTH, Frederick - Icon.txt | 2016-12-07 14:13 | 916K | |
| F Scott Fitzgerald - The Great Gatsby.txt | 2016-12-07 14:13 | 271K | |
| Fahrenheit 451.txt | 2016-12-07 14:20 | 245K | |
| FearAndLoathing.htm | 2016-12-07 14:32 | 303K | |
| Freud,_Sigmund_-_A_Young_Girl's_Diary.txt | 2016-12-07 14:11 | 467K | |
| Freud,_Sigmund_-_Interpretation_of_Dreams.txt | 2016-12-07 14:21 | 1.6M | |
| Fritjof Capra - The Tao of Physics.pdf | 2016-12-07 14:36 | 11M | |
| From_Political_Economy_to_Freakonomics.pdf | 2016-12-07 14:34 | 2.4M | |
| Fundamental Principles of the Metaphysic of Morals by Immanuel Kant.txt | 2016-12-07 14:12 | 187K | |
| Fundamentals of Power Electronics.pdf | 2016-12-07 14:13 | 5.1M | |
| Future-cities-visual-history.pdf | 2016-12-07 14:11 | 10M | |
| George Orwell/ | 2016-12-07 15:24 | - | |
| Giordano Bruno-Cause, Principle and Unity-And Essays on Magic.pdf | 2016-12-07 14:28 | 907K | |
| Golding, William - Lord of the Flies v1.0.txt | 2016-12-07 14:20 | 339K | |
| Greene, Graham - The Power and the Glory v1.0.rtf | 2016-12-07 14:13 | 426K | |
| H.G. Wells - Complete Works.pdf | 2016-12-07 14:41 | 11M | |
| HFilding.BridgetJonesDiary.doc | 2016-12-07 14:13 | 623K | |
| Heller, Joseph - Catch-22 v1.0.txt | 2016-12-07 14:11 | 1.0M | |
| Holistic Tarot_ An Integrative Approach to Using Tarot for Personal Growth.pdf | 2024-12-26 21:33 | 29M | |
| Horror/ | 2016-12-07 15:36 | - | |
| Hypnosis - Seven Success Secrets of Hypnotism.pdf | 2016-12-07 14:13 | 48K | |
| Illuminates_of_Thanateros.pdf | 2016-12-07 14:25 | 1.5M | |
| Illuminatus/ | 2016-12-07 16:51 | - | |
| Immanuel Kant - The Metaphysical Elements of Ethics/ | 2016-12-07 15:24 | - | |
| Immanuel Kant - Universal Natural History and Theory of Heaven.txt | 2016-12-07 14:40 | 312K | |
| Interview with Robert Anton Wilson.htm | 2016-12-07 14:08 | 47K | |
| Introduction_Africana_Philosophy.pdf | 2016-12-07 14:25 | 1.1M | |
| James Joyce - Ulysses (1922 Text)/ | 2016-12-07 14:54 | - | |
| John Gray - Men are from Mars, Women are from Venus (v2-1.0).rtf | 2016-12-07 14:20 | 1.0M | |
| John Gray - Men are from Mars, Women are from Venus (v2.0).rtf | 2016-12-07 14:24 | 1.0M | |
| John Stuart Mill - Utilitarianism/ | 2016-12-07 15:06 | - | |
| Journalism_Introduction.pdf | 2016-12-07 14:40 | 3.6M | |
| Kerouac, Jack - On The Road.txt | 2016-12-07 14:13 | 597K | |
| Kim, Ashida - Secrets of the Ninja.pdf | 2016-12-07 14:45 | 1.7M | |
| LEE, Harper - To Kill A Mockingbird.txt | 2016-12-07 14:32 | 740K | |
| Lewis Carrol/ | 2016-12-07 15:07 | - | |
| Liber (0242) CCXXLII - AHA!.pdf | 2016-12-07 14:13 | 46K | |
| Linux - Unix System Administration Handbook (Prentice Hall).pdf | 2016-12-07 14:24 | 302K | |
| Linux Web Solution - php - mySql - Apache.pdf | 2016-12-07 14:05 | 400K | |
| MARQUES, Gabriel Garcia - One Hundred Years of Solitude.txt | 2016-12-07 14:34 | 795K | |
| Madonna - Sex.pdf | 2016-12-07 14:32 | 6.4M | |
| Magic in ancient Egypt.pdf | 2016-12-07 14:18 | 5.4M | |
| Marquis De Sade - The 120 Days Of Sodom.txt | 2016-12-07 14:43 | 1.0M | |
| Martial-Arts_ Pressure Points - Military Hand to Hand Combat Guide.pdf | 2016-12-07 14:18 | 613K | |
| Martial Arts - Bruce Lee'S Jeet Kune Do.pdf | 2016-12-07 14:13 | 677K | |
| Martial Arts - Bruce Lee_S Jeet Kune Do.pdf | 2016-12-07 14:11 | 677K | |
| Martial Arts - Bruce Lee_s Speed Training.pdf | 2016-12-07 14:15 | 17K | |
| Martial Arts - Bruce Lee_s Training Secrets.pdf | 2016-12-07 14:11 | 12K | |
| Martial Arts - Qigong For Health And Vitality.pdf | 2016-12-07 14:32 | 13M | |
| Martial Arts_ - Bruce Lee - The Power Of The Dragon.pdf | 2016-12-07 14:19 | 1.1M | |
| Martial Arts_ - Self-Defense Nerve Centers and Pressure Points _1_.pdf | 2016-12-07 14:27 | 1.9M | |
![[ ]](/icons/compressed.gif) | Medicinal Herbs.zip | 2016-12-07 14:32 | 24K | |
| Meditations_of_Marcus_Aurelius.txt | 2016-12-07 14:44 | 403K | |
| Metamorphosis - Kafka, Franz.rtf | 2016-12-07 14:27 | 159K | |
| Miller, H; Burroughs, Kerouac/ | 2016-12-07 15:35 | - | |
| NLP Communication Model.pdf | 2016-12-07 14:27 | 147K | |
![[IMG]](/icons/image2.gif) | Nagaosa N. QFT in condensed matter physics (Springer, 1999)(T)(ISBN 3540655379)(214s).djvu | 2016-12-07 14:34 | 1.8M | |
| Nick Hornby - How to Be Good.doc | 2016-12-07 14:20 | 511K | |
| Ninja_Combat_Method_-_Stephen_K._Hayes.pdf | 2016-12-07 14:38 | 1.6M | |
| Ninja_Vol_1.pdf | 2016-12-07 14:07 | 10M | |
| Nonperturbative Quantum Field Theory and the Structure of Matter (Fundamental Theories of Physics).djvu | 2016-12-07 14:26 | 2.6M | |
| Oreilly.Learning.Unix.For.Mac.OS.X.Panther.eBook-LiB.chm.1.rar/ | 2016-12-07 15:24 | - | |
| PASTERNAK, Boris - Doctor Zhivago.txt | 2016-12-07 14:18 | 1.1M | |
| Paper Folding (ebook).pdf | 2016-12-07 14:05 | 734K | |
| Pressure Points.pdf | 2016-12-07 14:18 | 1.9M | |
| Qabbalistic Magic_ Talismans, Psalms, Amulets, and the Practice of High Ritual.pdf | 2024-12-26 21:30 | 33M | |
| Quentin Tarantino - Pulp Fiction script.txt | 2016-12-07 14:34 | 301K | |
| Ray Bradbury - Short Stories.txt | 2016-12-07 14:32 | 211K | |
| Rene Descartes - Meditations on First Philosophy.txt | 2016-12-07 14:34 | 170K | |
| Rene Descartes - Reason Discourse.txt | 2016-12-07 14:12 | 126K | |
| Rene Descartes - Truth in the Sciences.txt | 2016-12-07 14:05 | 126K | |
| Robert Anton Wilson- Illuminatus Trilogy.pdf | 2016-12-07 14:20 | 1.9M | |
| Robert Anton Wilson - Prometheus Rising.pdf | 2016-12-07 14:44 | 4.0M | |
| Robert_Anton_Wilson_-_Quantum_Psychology.pdf | 2016-12-07 14:15 | 8.0M | |
| Robert_Anton_Wilson_The_Illuminati_Papers.pdf | 2016-12-07 14:17 | 30M | |
| SHAKESPEAREgabEag.pdf | 2016-12-07 14:38 | 1.0M | |
| Saint Joan_A Chronicle Play In Six Scenes And An Epilogue.txt | 2016-12-07 14:17 | 317K | |
| Schrodinger's Cat/ | 2016-12-07 15:46 | - | |
| Science_Fiction_Quotations.pdf | 2016-12-07 14:26 | 5.5M | |
| Secrets of the Ninja.pdf | 2016-12-07 14:10 | 9.0M | |
| Sibelius Tutorial.pdf | 2016-12-07 14:36 | 91K | |
| Social Media Marketing.pdf | 2016-12-07 14:33 | 4.7M | |
| Stressbusting/ | 2016-12-07 15:06 | - | |
| Symbolsprache_Talismane_Amulette.pdf | 2016-12-07 14:33 | 3.9M | |
| THE THEORY AND TECHNIQUE OF ELECTRONIC MUSIC by Miller Puckette.pdf | 2016-12-07 14:20 | 1.9M | |
| Tai Chi Yang Sword Form 32.pdf | 2016-12-07 14:24 | 198K | |
| The 2-hour Tarot Tutor_ The Fast, Revolutionary Method for Learning to Read Tarot in 2 Hours.pdf | 2025-01-04 16:26 | 26M | |
| The Art of Scientific Investigation .pdf | 2016-12-07 14:34 | 12M | |
| The Brainwashing Manual .pdf | 2016-12-07 14:16 | 134K | |
| The Creative Mind_ Myths and Mechanisms.pdf | 2016-12-07 14:11 | 2.0M | |
| The Critique of Practical Reason by Immanuel Kant.txt | 2016-12-07 14:32 | 377K | |
| The Critique of Pure Reason by Immanuel Kant.txt | 2016-12-07 14:43 | 1.2M | |
| The Eighteenth Brumaire of Louis Bonaparte | 2016-12-07 14:34 | 254K | |
| The Filipino Martial Arts - Dan Inosanto.pdf | 2016-12-07 14:08 | 9.5M | |
| The Great Book of Magical Art, Hindu Magic and East Indian Occultism now combined with The Book of Secret Hindu, Ceremonial, and Talismanic Magic.pdf | 2024-12-26 21:28 | 24M | |
| The Illuminati Papers by Robert Anton Wilson.pdf | 2016-12-07 14:13 | 33K | |
| The Magick of Aleister Crowley_ A Handbook of the Rituals of Thelema.pdf | 2024-12-26 21:27 | 2.5M | |
| The Magick of Thelema_ A Handbook of the Rituals of Aleister Crowley.pdf | 2024-12-26 21:27 | 30M | |
| The Metaphysical Elements of Ethics by Immanuel Kant.txt | 2016-12-07 14:12 | 91K | |
| The Ritual Magic Manual_ A Complete Course in Practical Magic.pdf | 2025-01-04 16:30 | 45M | |
| The Shaggy Steed of Physics Mathematical Beauty in the Physical World.pdf | 2016-12-07 14:13 | 3.8M | |
| The Yoga Sutras of Patanjali by Charles Johnston.txt | 2016-12-07 14:19 | 184K | |
| The_Complete_Works_of_H.P._Lovecraft.pdf | 2016-12-07 14:39 | 7.8M | |
| The trial - Kafka, Franz/ | 2016-12-07 15:05 | - | |
| VISUALISING INFORMATION FOR ADVOCACY-VIFA_singlepage_large.pdf | 2016-12-07 14:43 | 71M | |
| Vampirella - (Ebook Comic Erotic).pdf | 2016-12-07 14:30 | 14M | |
| Veggie recipies/ | 2016-12-07 15:08 | - | |
| Visualising-Information-for-Advocacy-VIFA_download_large.pdf | 2016-12-07 14:30 | 77M | |
| Wilson, Robert Anton - Illuminatus Trilogy.pdf | 2016-12-07 14:18 | 1.7M | |
| afullerex Folder/ | 2016-12-07 15:05 | - | |
| aleister-crowley-selected-poems.pdf | 2017-04-22 06:43 | 530K | |
| allmetta.pdf | 2016-12-07 14:12 | 205K | |
| ananda1.pdf | 2016-12-07 14:13 | 1.0M | |
| anapanasati.pdf | 2016-12-07 14:12 | 1.2M | |
| applied_magic_dion_fortune.pdf | 2016-12-07 14:42 | 516K | |
| artofscientificinvestigation60beve.pdf | 2016-12-07 14:18 | 12M | |
| brave new world - by aldous huxley.txt | 2016-12-07 14:20 | 112K | |
| canterbury tales - by geoffrey chaucer.txt | 2016-12-07 14:20 | 182K | |
| catch22.pdf | 2016-12-07 14:45 | 1.3M | |
| crome_yellow_aldous_huxley.pdf | 2016-12-07 14:19 | 430K | |
| de gourmont - the natural philosophy of love.pdf | 2016-12-07 14:30 | 216K | |
| eBook - Aleister Crowley - Book of Lies.pdf | 2016-12-07 14:38 | 309K | |
| ebook.-.PDF.The.Brainwashing.Manual..pdf | 2016-12-07 14:16 | 134K | |
| ezine/ | 2016-12-07 14:57 | - | |
| fundbud1.pdf | 2016-12-07 14:32 | 278K | |
| gerd-ziegler-tarot-mirror-of-the-soul-handbook-for-the-aleister-crowley-tarot_1986_scan-ocr.pdf | 2024-12-26 21:24 | 60M | |
| good_evil_beyond.pdf | 2016-12-07 14:26 | 1.0M | |
| heart_s2.pdf | 2016-12-07 14:32 | 743K | |
| howtheysucceeded00mardrich.pdf | 2016-12-07 14:20 | 16M | |
| intuitive-awareness.pdf | 2016-12-07 14:20 | 511K | |
| invitation6.pdf | 2016-12-07 14:05 | 589K | |
| jaynes_The Study_of_the_History_of_Psychology.pdf | 2016-12-07 14:34 | 8.0K | |
| jaynes_consciousness-voices-mind.pdf | 2016-12-07 14:10 | 287K | |
| jotleeds.pdf | 2016-12-07 14:34 | 399K | |
| joyce - chamber music.pdf | 2016-12-07 14:11 | 37K | |
| joyce - ulysses.pdf | 2016-12-07 14:12 | 1.0M | |
| ksitigarbha.pdf | 2016-12-07 14:43 | 298K | |
| liaofan.pdf | 2016-12-07 14:12 | 1.0M | |
| libermmm.pdf | 2016-12-07 14:12 | 101K | |
| life universe and everything.pdf | 2016-12-07 14:43 | 388K | |
| mIRC/ | 2016-12-07 15:33 | - | |
| magick and hypnosis.doc | 2016-12-07 14:43 | 68K | |
| martial arts Pressure points.pdf | 2016-12-07 14:16 | 1.9M | |
| mindfulness_in_plain_english.pdf | 2016-12-07 14:18 | 638K | |
| mission-accomplished.pdf | 2016-12-07 14:15 | 1.2M | |
| monkeym.pdf | 2016-12-07 14:21 | 1.0M | |
| mstrhealing.pdf | 2016-12-07 14:36 | 1.1M | |
| restaurant end of universe.pdf | 2016-12-07 14:32 | 392K | |
| robert anton wilson - die neue inquisition (streamload).pdf | 2016-12-07 14:21 | 1.2M | |
| tedPAD-black.pdf | 2016-12-07 14:44 | 77K | |
| thanks for all the fish.pdf | 2016-12-07 14:24 | 342K | |
| the_book_of_ceremonial_magic.pdf | 2016-12-07 14:28 | 4.6M | |
| the_law_of_one_book_1.pdf | 2016-12-07 14:20 | 4.4M | |
| the_law_of_one_book_2.pdf | 2016-12-07 14:45 | 384K | |
| the_law_of_one_book_3.pdf | 2016-12-07 14:25 | 533K | |
| the_law_of_one_book_4.pdf | 2016-12-07 14:12 | 5.2M | |
| the_law_of_one_book_5.pdf | 2016-12-07 14:44 | 653K | |
| the cyberpunk fakebook.txt | 2016-12-07 14:06 | 35K | |
| volcanos.pdf | 2016-12-07 14:12 | 174K | |
|
|---|